Anodyne| Amoxicillin | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 365.4 g/mol [1] |
| Appearance | Crystals from water [1] |
| Odor | Penicillin-type odor [1] |
| Taste | Bitter tasting [1] |
| Melting point | 194 °C [1] |
| Solubility | 10.7 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | -2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C16H19N3O5S [1] |
| IUPAC name | (2S,5R,6R)-6-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid [1] |
| SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C [1] |
| InChI | InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10-,11+,14-/m1/s1 [1] |
| InChIKey | LSQZJLSUYDQPKJ-NJBDSQKTSA-N [1] |
| Dosing [] | |
|---|---|
| Elimination half-life | 61.3 minutes (~1 hour) |
Amoxicillin
Amoxicillin (also known as Amoxycillin, 26787-78-0, Amoxicillin anhydrous, Amoxicilline, p-Hydroxyampicillin, Amopenixin, Amoxicilina, Amolin, Moxal or Amoxil) is a antibiotic substance of the amino acid class.
Chemistry
Stereochemistry []
Amoxicillin is a absolute mixture
Legal status
- Australia: Amoxicillin is a S4 substance.
- Canada: Amoxicillin is a prescription only substance.
- United Kingdom: Amoxicillin is a prescription only substance.
- United States: Amoxicillin is a prescription only substance.