Pethidine
| Pethidine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 247.33 g/mol [1] |
| Appearance | Solid [1] |
| Melting point | 186 - 189 °C [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. [1] |
| Solubility | In water, 3.22X10+3 mg/L at 30 °C [1] |
| Predicted LogP | 2.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C15H21NO2 [1] |
| IUPAC name | ethyl 1-methyl-4-phenylpiperidine-4-carboxylate [1] |
| SMILES | CCOC(=O)C1(CCN(CC1)C)C2=CC=CC=C2 [1] |
| InChI | InChI=1S/C15H21NO2/c1-3-18-14(17)15(9-11-16(2)12-10-15)13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3 [1] |
| InChIKey | XADCESSVHJOZHK-UHFFFAOYSA-N [1] |
Pethidine (also known as meperidine, Isonipecaine, Meperidol, Pethanol, Pethidineter, Demerol, Pethidin, Phetidine, Nemerol or Pipersal) is a
Chemistry
Salts []
Pethidine is typically found in the form of its hydrochloride salt.
Stereochemistry []
Pethidine is a achiral mixture.