Cyproterone acetate
| CPA | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 416.9 g/mol [1] |
| Appearance | Crystals from diisopropyl ether [1] |
| Melting point | 200-201 [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /hydrogen chloride/. [1] |
| Solubility | Very soluble in dichloromethane and acetone; soluble in methanol; sparingly soluble in ethanol. [1] |
| Predicted LogP | 3.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C24H29ClO4 [1] |
| IUPAC name | [(1S,2S,3S,5R,11R,12S,15R,16S)-15-acetyl-9-chloro-2,16-dimethyl-6-oxo-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl] acetate [1] |
| SMILES | CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(=O)C5CC5C34C)Cl)C)OC(=O)C [1] |
| InChI | InChI=1S/C24H29ClO4/c1-12(26)24(29-13(2)27)8-6-16-14-10-20(25)19-11-21(28)15-9-18(15)23(19,4)17(14)5-7-22(16,24)3/h10-11,14-18H,5-9H2,1-4H3/t14-,15+,16-,17-,18-,22-,23-,24-/m0/s1 [1] |
| InChIKey | UWFYSQMTEOIJJG-FDTZYFLXSA-N [1] |
(Redirected from cyproterone acetate)
Cyproterone acetate (also known as Androcur, Cyproteroneacetate, Cyproterone 17-O-acetate, Cyproteron acetate, Cyproteron-R acetate, Cyprostat, SH 714, Cyproterone 17alpha-acetate, SH-714 or SH 80714) is a
Stereochemistry []
Cyproterone acetate is a