Anodyne| E2 | |
|---|---|
 | |
| Esters [] | |
|---|---|
| Estradiol acetate | |
| |
| Estradiol benzoate | |
| |
| Estradiol valerate | |
| |
| Estradiol cypionate | |
| |
| Estradiol enantate | |
| |
| Estradiol undecylate | |
| |
| Estradiol diundecylate | |
| |
| Estradiol propionate | |
| |
| Estradiol dipropionate | |
|
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Physical properties [] | |
|---|---|
| Molecular mass | 272.4 g/mol [1] |
| Appearance | White crystalline powder. Prisms from 80% alcohol [1] |
| Odor | Odorless [1] |
| Melting point | 178.5 °C [1] |
| Boiling point | 445.9±45.0 [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | Very soluble in acetone, ethanol, dioxane [1] |
| Predicted LogP | 4 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C18H24O2 [1] |
| IUPAC name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol [1] |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O [1] |
| InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 [1] |
| InChIKey | VOXZDWNPVJITMN-ZBRFXRBCSA-N [1] |
Estradiol
Estradiol (also known as Oestradiol, progynon, Diogynets, Aquadiol, Climara, Diogyn, Vagifem, Dimenformon, Estraderm or Estraldine)
Chemistry
Salts and Esters []
Estradiol is typically found in the form of its sodium and hemihydrate salts
or its acetate, benzoate, valerate, cypionate, enantate, undecylate, diundecylate, propionate and dipropionate esters.
Stereochemistry []
Estradiol is a absolute mixture
| Anodyne Usernotes [] | |
|---|---|
| 0xea / Estradiol[hemihydrate] via | life saving hormone; caused figure changes, breast growth, body hair reduction, skin smoothing and emotional enhancements |
External links []
References []
National Center for Biotechnology Information. PubChem Compound Summary for CID 5757, Estradiol. Accessed July 5, 2025. https://pubchem.ncbi.nlm.nih.gov/compound/5757
U.S. Food and Drug Administration; National Center for Advancing Translational Sciences. Estradiol. UNII: 4TI98Z838E. Global Substance Registration System. Accessed July 5, 2025. https://gsrs.ncats.nih.gov/ginas/app/beta/substances/4TI98Z838E