Anodyne| E2 | |
|---|---|
 |
| Salts [] | |
|---|---|
| Sodium estradiol | |
| |
| Estradiol hemihydrate | |
|
| Esters [] | |
|---|---|
| Estradiol acetate | |
| |
| Estradiol benzoate | |
| |
| Estradiol valerate | |
| |
| Estradiol cypionate | |
| |
| Estradiol enantate | |
| |
| Estradiol undecylate | |
| |
| Estradiol diundecylate | |
| |
| Estradiol propionate | |
| |
| Estradiol dipropionate | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C18H24O2[1] |
|---|---|
| Molecular mass | 272.4 g/mol[1] |
| Appearance | White crystalline powder. Prisms from 80% alcohol[1] |
| Odor | Odorless[1] |
| Predicted LogP | 4[1] |
| Melting point | 178.5 °C[1] |
| Boiling point | 445.9±45.0[1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes.[1] |
| Solubility | Very soluble in acetone, ethanol, dioxane[1] |
| Chirality | absolute[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol[1] |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O[1] |
| InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1[1] |
| InChIKey | VOXZDWNPVJITMN-ZBRFXRBCSA-N[1] |
| Dosing |
|---|
Estradiol
Estradiol (also known as Oestradiol, progynon, Diogynets, Aquadiol, Climara, Diogyn, Vagifem, Dimenformon, Estraderm or Estraldine) is a substance of the steroid class.
Chemistry
Estradiol is typically found in the form of its sodium and hemihydrate salts or its acetate, benzoate, valerate, cypionate, enantate, undecylate, diundecylate, propionate and dipropionate esters.
Stereochemistry
Estradiol is a absolute mixture