| 5-HT | |
|---|---|
| Esters [] | |
|---|---|
| Serotonin propionate | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 176.21 g/mol [1] |
| Solubility | 25.5 mg/mL [1] |
| Predicted LogP | 0.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C10H12N2O [1] |
| IUPAC name | 3-(2-aminoethyl)-1H-indol-5-ol [1] |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CCN [1] |
| InChI | InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 [1] |
| InChIKey | QZAYGJVTTNCVMB-UHFFFAOYSA-N [1] |
Serotonin
Serotonin (also known as 3-(2-Aminoethyl)-1H-indol-5-ol, Enteramine, Thrombotonin, Antemovis, Serotonine, Ds substance, Antemoqua, Hippophain, Substance DS or Substanz DS) is a
Chemistry
Salts and Esters []
Serotonin is typically found in the form of its hydrochloride and adipate salts
or its propionate ester.
Stereochemistry []
Serotonin is a achiral mixture