| Propofol | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 178.27 g/mol [1] |
| Density | 0.955 g/cu cm @ 20 °C g/cm3 [1] |
| Appearance | Light-straw-colored liquid [1] |
| Melting point | 18 °C [1] |
| Boiling point | 242 °C [1] |
| Solubility | Insoluble in water. Soluble in alcohol and toluene. [1] |
| Predicted LogP | 3.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H18O [1] |
| IUPAC name | 2,6-di(propan-2-yl)phenol [1] |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)O [1] |
| InChI | InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 [1] |
| InChIKey | OLBCVFGFOZPWHH-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 1.5–31 hours |
| Duration of action | ~5–10 minutes |
Propofol
Propofol (also known as 2,6-Diisopropylphenol, Disoprivan, Ampofol, 2,6-Bis(1-methylethyl)phenol, Rapinovet, Propofolum, Pofol, Phenol, 2,6-diisopropyl-, Diprifusor or Diprofol) is a
Chemistry
Stereochemistry []
Propofol is a achiral mixture
Legal status []
- Australia: Propofol is a S4 substance.
- Brazil: Propofol is a C1 substance.
- Canada: Propofol is a prescription only substance.
- United Kingdom: Propofol is a prescription only substance.
- United States: Propofol is a prescription only substance.