| Lidocaine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 234.34 g/mol [1] |
| Appearance | Needles from benzene or alcohol [1] |
| Odor | Characteristic odor [1] |
| Melting point | 68 °C [1] |
| Boiling point | 159-160 °C at 2.00E+00 mm Hg [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. [1] |
| Solubility | >35.2 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 2.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C14H22N2O [1] |
| IUPAC name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide [1] |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C [1] |
| InChI | InChI=1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) [1] |
| InChIKey | NNJVILVZKWQKPM-UHFFFAOYSA-N [1] |
Lidocaine
Lidocaine (also known as Lignocaine, 2-(Diethylamino)-N-(2,6-dimethylphenyl)acetamide, Xylocaine, Lidoderm, Duncaine, Esracaine, Xylestesin, Alphacaine, Cappicaine or Gravocain)
Chemistry
Salts []
Lidocaine is typically found in the form of its tosylate, hydrochloride, carbonate, bicarbonate, iminodiacetic acid, maleate and sulfate salts.
Stereochemistry []
Lidocaine is a achiral mixture
Anodyne