| Hydrocortisone | |
|---|---|
| Esters [] | |
|---|---|
| Hydrocortisone acetate | |
| Hydrocortisone valerate | |
| Hydrocortisone cypionate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 362.5 g/mol [1] |
| Appearance | Plates from alc or iso-propyl alc [1] |
| Odor | Odorless [1] |
| Taste | Bitter taste [1] |
| Melting point | 217-220 °C with some decomposition [1] |
| Solubility | Amorphous, hygroscopic, white powder. Mp 169.0-171.2 °C. Solubility in water: approx 500 mg/mL. Similarly soluble in methanol, ethanol,; sparingly soluble in chloroform. /21-Sodium succinate/ [1] |
| Predicted LogP | 1.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C21H30O5 [1] |
| IUPAC name | (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one [1] |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O [1] |
| InChI | InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 [1] |
| InChIKey | JYGXADMDTFJGBT-VWUMJDOOSA-N [1] |
Hydrocortisone
Hydrocortisone (also known as Cortisol, Acticort, Cetacort, Cortef, Hydrasson, Hydrocortisyl, Hydrocortone, Cobadex, Hytone or Cortenema) is a
Chemistry
Esters []
Hydrocortisone is typically found in the form of its acetate, valerate and cypionate esters.
Stereochemistry []
Hydrocortisone is a absolute mixture
| Anodyne Usernotes [] | |
|---|---|
| 0xea / Hydrocortisone via Dermal |
|
Anodyne