Desomorphine | |
---|---|
Molecular structure via molpic based on CDK |
Physical properties [] | |
---|---|
Molecular mass | 271.35 g/mol [1] |
Appearance | Rectangular plates from acetone-water [1] |
Boiling point | Sublimes in high vacuum between 140 and 170 °C [1] |
Decomposition | When heated to decomposition it emits toxic fumes of /oxides of nitrogen/. [1] |
Solubility | Soluble in acetone, ethyl acetate [1] |
Predicted LogP | 2.8 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C17H21NO2 [1] |
IUPAC name | (4R,4aR,7aS,12bS)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol [1] |
SMILES | CN1CC[C@]23[C@@H]4[C@H]1CC5=C2C(=C(C=C5)O)O[C@H]3CCC4 [1] |
InChI | InChI=1S/C17H21NO2/c1-18-8-7-17-11-3-2-4-14(17)20-16-13(19)6-5-10(15(16)17)9-12(11)18/h5-6,11-12,14,19H,2-4,7-9H2,1H3/t11-,12+,14-,17+/m0/s1 [1] |
InChIKey | LNNWVNGFPYWNQE-GMIGKAJZSA-N [1] |
Desomorphine
Desomorphine (also known as Dihydrodeoxymorphine, Permonid, Desomorfina, Krokodil, Deoxydihydromorphine D, Dihydrodesoxymorphine D, Desomorphinum, Desomorfin, Dihydrodesoxymorphine-D or 4,5-Epoxy-3-hydroxy-N-methylmorphinan) is a
Chemistry
Salts []
Desomorphine is typically found in the form of its hydrobromide and hydrochloride salts.
Stereochemistry []
Desomorphine is a absolute mixture