Desmetramadol
| O-DSMT | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via JSmol |
| Physical properties [] | |
|---|---|
| Molecular mass | 249.35 g/mol [1] |
| Predicted LogP | 2.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C15H23NO2 [1] |
| IUPAC name | 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenol [1] |
| SMILES | CN(C)C[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)O)O [1] |
| InChI | InChI=1S/C15H23NO2/c1-16(2)11-13-6-3-4-9-15(13,18)12-7-5-8-14(17)10-12/h5,7-8,10,13,17-18H,3-4,6,9,11H2,1-2H3/t13-,15+/m1/s1 [1] |
| InChIKey | UWJUQVWARXYRCG-HIFRSBDPSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 6-8 hours |
Desmetramadol (also known as O-Desmethyltramadol, O-desmethyl tramadol, O-Demethyltramadol, Mono-O-demethyltramadol, tramadol M1 metabolite, 80456-81-1, O-Demethyl tramadol, Tramadol hydrochloride impurity d, 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxy-cyclohexyl]phenol or (Rr,ss)-3-(2-((dimethylamino)methyl)-1-hydroxycyclohexyl)phenol) is a opioid substance of the ethylamine class.
Chemistry
Stereochemistry []
(RS)-Desmetramadol is a racemic mixture of the optical stereoisomers