Anodyne| Phenobarbital | |
|---|---|
 |
| Salts [] | |
|---|---|
| Sodium phenobarbital | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C12H12N2O3[1] |
|---|---|
| Molecular mass | 232.23 g/mol[1] |
| Appearance | Crystals (3 different phases)[1] |
| Odor | Odorless[1] |
| Taste | Slightly bitter taste[1] |
| Predicted LogP | 1.5[1] |
| Melting point | 345 to 352 °F (NTP, 1992)[1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/.[1] |
| Solubility | >34.8 [ug/mL] (The mean of the results at pH 7.4)[1] |
| Chirality | achiral[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione[1] |
| SMILES | CCC1(C(=O)NC(=O)NC1=O)C2=CC=CC=C2[1] |
| InChI | InChI=1S/C12H12N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17)[1] |
| InChIKey | DDBREPKUVSBGFI-UHFFFAOYSA-N[1] |
| Dosing | |
|---|---|
| Elimination half-life | 53–118 hours |
| Duration of action | 4 hours–2 days |
Phenobarbital
Phenobarbital (also known as Phenobarbitone, Phenobarbitol, Phenylethylbarbiturate, Fenobarbital, Phenobarbituric acid, Phenylethylmalonylurea, Phenemal, Adonal, Nunol or Phenylethylbarbituric acid) is a substance of the barbiturate class.
Chemistry
Phenobarbital is typically found in the form of its sodium salt.
Stereochemistry
Phenobarbital is a achiral mixture
Legal status
- Australia: Phenobarbital is a S4 substance.
- Brazil: Phenobarbital is a B1 substance.
- Canada: Phenobarbital is a Schedule IV substance.
- Germany: Phenobarbital is a prescription only/Anlage III substance.
- United Kingdom: Phenobarbital is a Class B substance.
- United States: Phenobarbital is a Schedule IV substance.