Anodyne| Metaradrine | |
|---|---|
 |
| Salts [] | |
|---|---|
| Metaraminol bitartrate | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C9H13NO2[1] |
|---|---|
| Molecular mass | 167.20 g/mol[1] |
| Predicted LogP | -0.4[1] |
| Melting point | 107.5 °C[1] |
| Decomposition | When heated to decomposition it emits toxic fumes of nitroxides.[1] |
| Solubility | SOLUBILITY IN ALCOHOL: 1 G/100 ML /BITARTRATE/[1] |
| Chirality | absolute[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol[1] |
| SMILES | C[C@@H]([C@@H](C1=CC(=CC=C1)O)O)N[1] |
| InChI | InChI=1S/C9H13NO2/c1-6(10)9(12)7-3-2-4-8(11)5-7/h2-6,9,11-12H,10H2,1H3/t6-,9-/m0/s1[1] |
| InChIKey | WXFIGDLSSYIKKV-RCOVLWMOSA-N[1] |
| Dosing |
|---|
Metaraminol
Metaraminol (also known as Hydroxynorephedrine, m-Hydroxypropadrine, Pressonex, m-Hydroxy norephedrine, 1-Metaraminol, (-)-Erythro-metaraminol, Pressorol, m-Hydroxyphenylpropanolamine, Icoral B or Metaraminolum) is a sympathomimetic substance of the phenylethanolamine class.
Chemistry
Metaraminol is typically found in the form of its bitartrate salt.
Stereochemistry
Metaraminol is a absolute mixture
Legal status
- Australia: Metaraminol is a S4 substance.
- United Kingdom: Metaraminol is a prescription only substance.
- United States: Metaraminol is a prescription only substance.