Anodyne| Fentanyl | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Physical properties [] | |
|---|---|
| Molecular mass | 336.5 g/mol [1] |
| Appearance | Crystals [1] |
| Melting point | 83-84 [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. [1] |
| Solubility | 0.74mg/mL [1] |
| Predicted LogP | 4 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C22H28N2O [1] |
| IUPAC name | N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide [1] |
| SMILES | CCC(=O)N(C1CCN(CC1)CCC2=CC=CC=C2)C3=CC=CC=C3 [1] |
| InChI | InChI=1S/C22H28N2O/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19/h3-12,21H,2,13-18H2,1H3 [1] |
| InChIKey | PJMPHNIQZUBGLI-UHFFFAOYSA-N [1] |
| Dosing [] | |
|---|---|
| Elimination half-life | Intravaneous: 6 mins (T1/2 α) 1 hours (T1/2 β) 16 hours (T1/2 ɣ) Intranasal: 15–25 hours Transdermal: 20–27 hours Sublingual: 5–13.5 hours Buccal: 3.2–6.4 hours |
| Duration of action | Intravaneous: 30–60 minutes |
| Transdermal [] | |
|---|---|
| Threshold | 2.5 - 14.5 µg |
| Light | 14.5 - 25 µg |
| Common | 25 - 50 µg |
| Strong | 50 - 100 µg |
| Heavy | 100 µg |
| Statistically derived dosages by Sernyl |
Fentanyl
Fentanyl (also known as Phentanyl, Fentanil, Durogesic, Fentanila, Fentanylum, Sentonil, Sublimase, Matrifen, Duragesic-100 or N-(1-Phenethylpiperidin-4-yl)-N-phenylpropionamide) is a
Chemistry
Salts []
Fentanyl is typically found in the form of its citrate and hydrochloride salts.
Stereochemistry []
Fentanyl is a achiral mixture
Legal status
- Australia: Fentanyl is a S8 substance.
- Brazil: Fentanyl is a Class A1 substance.
- Canada: Fentanyl is a Schedule I substance.
- Germany: Fentanyl is a Anlage III substance.
- New Zealand: Fentanyl is a Class B substance.
- United Kingdom: Fentanyl is a Class A substance.
- United States: Fentanyl is a Schedule II substance.
- European Union: Fentanyl is a prescription only substance.
- United Nations: Fentanyl is a Schedule I narcotic under the "Single Convention on Narcotic Drugs 1961".