Anodyne| Ala | |
|---|---|
 | |
| Esters [] | |
|---|---|
| Alanine acetate | |
| |
| Alanine benzoate | |
|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 89.09 g/mol [1] |
| Solubility | Solublein water [1] |
| Predicted LogP | -3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C3H7NO2 [1] |
| IUPAC name | 2-aminopropanoic acid [1] |
| SMILES | CC(C(=O)O)N [1] |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) [1] |
| InChIKey | QNAYBMKLOCPYGJ-UHFFFAOYSA-N [1] |
Alanine
Alanine (also known as DL-ALANINE, DL-2-Aminopropionic acid, D,L-Alanine, DL-2-Aminopropanoic acid, AI3-08908, CCRIS 8596, Dl-alanine, Fema no. 3818, DLαAlanine or D,LAlanine) is a
Chemistry
Esters []
Alanine is typically found in the form of its acetate and benzoate esters.
Stereochemistry []
DL-Alanine is a racemic mixture of the logical stereoisomers