Triprolidine
| Triprolidine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via JSmol |
| Physical properties [] | |
|---|---|
| Molecular mass | 278.4 g/mol [1] |
| Appearance | Crystals from light petroleum [1] |
| Melting point | 59-61 °C [1] |
| Solubility | 5.37e-02 g/L [1] |
| Predicted LogP | 3.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C19H22N2 [1] |
| IUPAC name | 2-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]pyridine [1] |
| SMILES | CC1=CC=C(C=C1)/C(=C\CN2CCCC2)/C3=CC=CC=N3 [1] |
| InChI | InChI=1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+ [1] |
| InChIKey | CBEQULMOCCWAQT-WOJGMQOQSA-N [1] |
Triprolidine (also known as Triprolidin, Tripolidina, Triprolidinum, Triprolidina, CCRIS 7212, trans-1-(2-Pyridyl)-3-pyrrolidino-1-p-tolylprop-1-ene, NCI-C61450, trans-1-(4-Methylphenyl)-1-(2-pyridyl)-3-pyrrolidinoprop-1-ene, trans-2-(3-(1-Pyrrolidinyl)-1-p-tolylpropenyl)pyridine or (E)-2-(1-(4-Methylphenyl)-3-(1-pyrrolidinyl)-1-propenyl)pyridine) is a
Chemistry
Salts []
Triprolidine is typically found in the form of its hydrochloride salt.
Stereochemistry []
Triprolidine is a achiral mixture