Anodyne| Menthol | |
|---|---|
 |
| Esters [] | |
|---|---|
| Menthol acetate | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C10H20O[1] |
|---|---|
| Molecular mass | 156.26 g/mol[1] |
| Density | 0.904 at 59 °F (NTP, 1992) - Less dense than water; will float g/cm3[1] |
| Appearance | Crystals or granules[1] |
| Odor | Peppermint odor[1] |
| Taste | Peppermint taste[1] |
| Predicted LogP | 3[1] |
| Melting point | 100 °[1] |
| Boiling point | 421 °[1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes.[1] |
| Solubility | less than 1 mg/mL at 70 °F (NTP, 1992)[1] |
| Chirality | racemic[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol[1] |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)O)C(C)C[1] |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1[1] |
| InChIKey | NOOLISFMXDJSKH-KXUCPTDWSA-N[1] |
| Dosing |
|---|
Menthol
Menthol (also known as l-Menthol, (-)-menthol, Levomenthol, l-(-)-Menthol, Menthomenthol, (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol, Menthacamphor, Peppermint camphor, (1r,2s,5r)-(-)-menthol or Levomentholum) is a substance of the class.
Chemistry
Menthol is typically found in the form of its acetate ester.
Stereochemistry
(RS)-Menthol is a racemic mixture of the optical stereoisomers:
| Stereoisomers [] |
|---|
|
(+)-Menthol -menthol.svg)
(-)-Menthol -menthol.svg)
(-)-Menthol
(-)-Menthol
|
Subjective effects
See also
External links
- Menthol (Wikipedia)
- Menthol / (+)-Menthol (Wikidata)
- Menthol / (+)-Menthol (DrugBank)
- Menthol / (+)-Menthol (PubChem)
- Menthol / (+)-Menthol (ChEMBL)
- Menthol / (+)-Menthol (ChEBI)
- Menthol / (+)-Menthol (Common Chemistry)
- Menthol (HMDB)
- Menthol (KEGG)
- Menthol / (+)-Menthol (UNII)
- Menthol / (+)-Menthol (EPA DSSTox)