Leu | |
---|---|
Esters [] | |
---|---|
Leucine palmitate | |
Molecular structure via molpic based on CDK |
Conformer [] | |
---|---|
Physical properties [] | |
---|---|
Molecular mass | 131.17 g/mol [1] |
Predicted LogP | -1.5 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C6H13NO2 [1] |
IUPAC name | 2-amino-4-methylpentanoic acid [1] |
SMILES | CC(C)CC(C(=O)O)N [1] |
InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) [1] |
InChIKey | ROHFNLRQFUQHCH-UHFFFAOYSA-N [1] |
Leucine
Leucine (also known as DL-Leucine, Dl-leucine, AI3-26709, 206-328-2, H-DL-Leu-OH, 2-Amino-4-methylpentanoic acid, (RS)-Leucine, 25322-63-8, (+-)-Leucine or ( inverted exclamation markA)-Leucine) is a
Chemistry
Salts and Esters []
Leucine is typically found in the form of its hydrochloride salt
or its palmitate ester.
Stereochemistry []
DL-Leucine is a racemic mixture of the logical stereoisomers