| Ibuprofen | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 206.28 g/mol [1] |
| Appearance | Colorless, crystalline stable solid [1] |
| Odor | Characteristic odor [1] |
| Melting point | 75-77.5 ÂșC [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and fumes. [1] |
| Solubility | Readily sol in most org solvents [1] |
| Predicted LogP | 3.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C13H18O2 [1] |
| IUPAC name | 2-[4-(2-methylpropyl)phenyl]propanoic acid [1] |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O [1] |
| InChI | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) [1] |
| InChIKey | HEFNNWSXXWATRW-UHFFFAOYSA-N [1] |
Ibuprofen
Ibuprofen (also known as 2-(4-Isobutylphenyl)propanoic acid, Motrin, Brufen, Advil, Nurofen, Dolgit, Liptan, Medipren, Nuprin or Anflagen)
Chemistry
Stereochemistry []
Ibuprofen is a racemic mixture of the optical stereoisomers
| Anodyne Usernotes [] | |
|---|---|
| 0xea / Ibuprofen via Oral |
|
Anodyne