| Hydromorphone | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via JSmol |
| Physical properties [] | |
|---|---|
| Molecular mass | 285.34 g/mol [1] |
| Appearance | Crystals from ethanol [1] |
| Odor | Odorless [1] |
| Melting point | Decomposes at 305ºC [1] |
| Boiling point | Decomposes at 305ºC [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. [1] |
| Solubility | Highly soluble [1] |
| Predicted LogP | 1.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C17H19NO3 [1] |
| IUPAC name | (4R,4aR,7aR,12bS)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one [1] |
| SMILES | CN1CC[C@]23[C@@H]4[C@H]1CC5=C2C(=C(C=C5)O)O[C@H]3C(=O)CC4 [1] |
| InChI | InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,16,19H,3,5-8H2,1H3/t10-,11+,16-,17-/m0/s1 [1] |
| InChIKey | WVLOADHCBXTIJK-YNHQPCIGSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 2–3 hours |
| Duration of action | 4–5 hours |
| Dosing[] |
|---|
| Intravenous [] | |
|---|---|
| Threshold | 1 |
| Light | 1 - 1.375 |
| Common | 1.375 - 4 |
| Strong | 4 |
| Heavy | 4 - 6.4499999999999975 |
| Insufflated [] | |
|---|---|
| Threshold | 4 |
| Light | ≤ 4 |
| Common | 4 |
| Strong | 4 |
| Heavy | 4 |
| Oral [] | |
|---|---|
| Threshold | 1 - 2 |
| Light | ≤ 2 |
| Common | 2 - 2.5 |
| Strong | 2.5 - 4 |
| Heavy | 4 - 8 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Hydromorphone
Hydromorphone (also known as Dihydromorphinone, Hydromorphon, Idromorfone, Novolaudon, DiMo, Dihydromorfinon, Hidromorfona, Hydromorfona, 7,8-Dihydromorphinone or Dilaudid Oros) is a
Chemistry
Salts []
Hydromorphone is typically found in the form of its hydrochloride and sulfate salts.
Stereochemistry []
Hydromorphone is a absolute mixture
Legal status []
- Australia: Hydromorphone is a S8 substance.
- Brazil: Hydromorphone is a A1 substance.
- Canada: Hydromorphone is a Schedule I substance.
- Germany: Hydromorphone is a Anlage III substance.
- New Zealand: Hydromorphone is a Class B substance.
- United Kingdom: Hydromorphone is a Class A substance.
- United States: Hydromorphone is a Schedule II substance.
- United Nations: Hydromorphone is a Schedule I narcotic under the "Single Convention on Narcotic Drugs 1961".