| Hydrocodone | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 299.4 g/mol [1] |
| Appearance | Prisms from alcohol [1] |
| Melting point | 198 °C [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxide/. [1] |
| Solubility | Soluble in acetone, ethyl acetate, chloroform [1] |
| Predicted LogP | 2.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C18H21NO3 [1] |
| IUPAC name | (4R,4aR,7aR,12bS)-9-methoxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one [1] |
| SMILES | CN1CC[C@]23[C@@H]4[C@H]1CC5=C2C(=C(C=C5)OC)O[C@H]3C(=O)CC4 [1] |
| InChI | InChI=1S/C18H21NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3,6,11-12,17H,4-5,7-9H2,1-2H3/t11-,12+,17-,18-/m0/s1 [1] |
| InChIKey | LLPOLZWFYMWNKH-CMKMFDCUSA-N [1] |
| Dosing[] |
|---|
| Insufflated [] | |
|---|---|
| Threshold | 0.5 - 1 |
| Light | 1 - 2.625 |
| Common | 2.625 - 7.5 |
| Strong | 7.5 - 10 |
| Heavy | 10 - 19.50000000000001 |
| Oral [] | |
|---|---|
| Threshold | 0.5 - 2 |
| Light | 2 - 5 |
| Common | 5 - 10 |
| Strong | 10 - 20 |
| Heavy | 20 - 24.800000000000068 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Hydrocodone
Hydrocodone (also known as Dihydrocodeinone, Hydrocodon, Hydrocone, Hydroconum, Multacodin, Bekadid, Codinovo, hidrocodona, Idrocodone or (-)-Dihydrocodeinone) is a
Chemistry
Salts []
Hydrocodone is typically found in the form of its tartrate, bitartrate, hydrochloride, monohydrate, hydrochloride dihydrate and dihydrate salts.
Stereochemistry []
Hydrocodone is a absolute mixture
Anodyne