| Aripiprazole | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 448.4 g/mol [1] |
| Appearance | Colorless, flake crystals from ethanol [1] |
| Melting point | 137-140 [1] |
| Boiling point | 139.0-139.5 °C [1] |
| Solubility | <0.3 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 4.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C23H27Cl2N3O2 [1] |
| IUPAC name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one [1] |
| SMILES | C1CC(=O)NC2=C1C=CC(=C2)OCCCCN3CCN(CC3)C4=C(C(=CC=C4)Cl)Cl [1] |
| InChI | InChI=1S/C23H27Cl2N3O2/c24-19-4-3-5-21(23(19)25)28-13-11-27(12-14-28)10-1-2-15-30-18-8-6-17-7-9-22(29)26-20(17)16-18/h3-6,8,16H,1-2,7,9-15H2,(H,26,29) [1] |
| InChIKey | CEUORZQYGODEFX-UHFFFAOYSA-N [1] |
Aripiprazole
Aripiprazole (also known as Abilify, Abilitat, Abilify Discmelt, aripiprazol, OPC-14597, Discmelt, Aripiprex, Abilify MyCite, OPC 31 or Abilify Maintena)
Chemistry
Salts []
Aripiprazole is typically found in the form of its monohydrate salt.
Stereochemistry []
Aripiprazole is a achiral mixture
| Anodyne Usernotes [] | |
|---|---|
| 0xea / Aripiprazole via Oral at 5mg oral |
|
Anodyne