Anodyne| Thiopental | |
|---|---|
 |
| Salts [] | |
|---|---|
| Sodium thiopental | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C11H18N2O2S[1] |
|---|---|
| Molecular mass | 242.34 g/mol[1] |
| Predicted LogP | 2.9[1] |
| Decomposition | When heated to decomposition it emits very toxic fumes of /nitrogen and sulfur oxides/.[1] |
| Solubility | 3.98e-02 g/L[1] |
| Chirality | racemic[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 5-ethyl-5-pentan-2-yl-2-sulfanylidene-1,3-diazinane-4,6-dione[1] |
| SMILES | CCCC(C)C1(C(=O)NC(=S)NC1=O)CC[1] |
| InChI | InChI=1S/C11H18N2O2S/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16)[1] |
| InChIKey | IUJDSEJGGMCXSG-UHFFFAOYSA-N[1] |
| Dosing | |
|---|---|
| Elimination half-life | 5.5–26 hours |
| Duration of action | 5–10 minutes |
Thiopental
Thiopental (also known as Pentothiobarbital, Penthiobarbital, Thiopentone, Thiopentobarbital, Thiomebumal, Thionembutal, Thiopentobarbitone, 76-75-5, Thiopentobarbituric acid or Thiothal)
Chemistry
Thiopental is typically found in the form of its sodium salt.
Stereochemistry
(RS)-Thiopental is a racemic mixture of the optical stereoisomers
Legal status
- Australia: Thiopental is a S4 substance.
- Brazil: Thiopental is a B1 substance.
- Canada: Thiopental is a Schedule IV substance.
- United States: Thiopental is a Schedule III substance.
- United Kingdom: Thiopental is a Class B substance.