Temazepam
| Temazepam | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 300.74 g/mol [1] |
| Melting point | 119-121 °C [1] |
| Solubility | 5.34e-02 g/L [1] |
| Predicted LogP | 2.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C16H13ClN2O2 [1] |
| IUPAC name | 7-chloro-3-hydroxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one [1] |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)O)C3=CC=CC=C3 [1] |
| InChI | InChI=1S/C16H13ClN2O2/c1-19-13-8-7-11(17)9-12(13)14(18-15(20)16(19)21)10-5-3-2-4-6-10/h2-9,15,20H,1H3 [1] |
| InChIKey | SEQDDYPDSLOBDC-UHFFFAOYSA-N [1] |
| Dosing[] |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 2.8000000000000003 |
| Light | 2.8000000000000003 - 20 |
| Common | 20 - 30 |
| Strong | 30 - 60 |
| Heavy | 60 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Temazepam (also known as Restoril, Hydroxydiazepam, Methyloxazepam, Oxydiazepam, Crisonar, Levanxene, Levanxol, N-Methyloxazepam, Euhypnos or Mabertin) is a
Stereochemistry []
Temazepam is a
Pharmacology
ATC Classification
In the nervous system (N) temazepam actsMetabolism
Subjective effects []
| magnus / Temazepam [] | |
|---|---|
| |