Anodyne| Stilbestrol | |
|---|---|
 |
| Esters [] | |
|---|---|
| Stilbestrol propionate | |
| |
| Stilbestrol dipropionate | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C18H20O2[1] |
|---|---|
| Molecular mass | 268.3 g/mol[1] |
| Appearance | White crystalline powder[1] |
| Odor | Odorless[1] |
| Predicted LogP | 5.1[1] |
| Melting point | 336 to 342 °F (NTP, 1992)[1] |
| Decomposition | When heated to decomposition it emits acrid smoke and fumes.[1] |
| Solubility | less than 1 mg/mL at 68 °F (NTP, 1992)[1] |
| Chirality | achiral[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol[1] |
| SMILES | CC/C(=C(/CC)\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)O[1] |
| InChI | InChI=1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17+[1] |
| InChIKey | RGLYKWWBQGJZGM-ISLYRVAYSA-N[1] |
| Dosing |
|---|
Stilbestrol
Stilbestrol (also known as diethylstilbestrol, Stilboestrol, Distilbene, Estrobene, Estromenin, Stilbetin, Stilboestroform, Antigestil, Palestrol or Synestrin)
Chemistry
Stilbestrol is typically found in the form of its propionate and dipropionate esters.
Stereochemistry
Stilbestrol is a achiral mixture