Anodyne| Primidone | |
|---|---|
 | |
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C12H14N2O2[1] |
| Molecular mass | 218.25 g/mol[1] |
| Appearance | Crystals[1] |
| Odor | Odorless[1] |
| Taste | Practically tasteless[1] |
| Predicted LogP | 0.9[1] |
| Melting point | 538 to 540 °F (NTP, 1992)[1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/.[1] |
| Solubility | >32.7 [ug/mL] (The mean of the results at pH 7.4)[1] |
| Chirality | achiral[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 5-ethyl-5-phenyl-1,3-diazinane-4,6-dione[1] |
| SMILES | CCC1(C(=O)NCNC1=O)C2=CC=CC=C2[1] |
| InChI | InChI=1S/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16)[1] |
| InChIKey | DQMZLTXERSFNPB-UHFFFAOYSA-N[1] |
| Dosing | |
|---|---|
| Elimination half-life | Primidone: 5-18 h, Phenobarbital: 75-120 h, PEMA: 16 h Time to reach steady state: Primidone: 2-3 days, Phenobarbital&PEMA 1-4weeks |
Primidone
Primidone (also known as Primaclone, Lepimidin, 2-Deoxyphenobarbital, Neurosyn, Mysedon, Primidon, Primacone, Primidona, Primacione or Primidonum) is a substance of the barbiturate class.
Chemistry
Stereochemistry
Primidone is a achiral mixture
Legal status
- Australia: Primidone is a S4 substance.
- Brazil: Primidone is a C1 substance.
- Canada: Primidone is a prescription only substance.
- United Kingdom: Primidone is a prescription only substance.
- United States: Primidone is a prescription only substance.