Phenylephrine
| Phenylephrine | |
|---|---|
| Esters [] | |
|---|---|
| Phenylephrine palmitate | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 167.20 g/mol [1] |
| Predicted LogP | -0.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H13NO2 [1] |
| IUPAC name | 3-[1-hydroxy-2-(methylamino)ethyl]phenol [1] |
| SMILES | CNCC(C1=CC(=CC=C1)O)O [1] |
| InChI | InChI=1S/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3 [1] |
| InChIKey | SONNWYBIRXJNDC-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 2–3 hours |
| Duration of action | IV: 20 min–5 h Oral: 2–4 h Intranasal: 0.5–4 h Eye drop: 3–7 h |
Phenylephrine (also known as 3-[1-Hydroxy-2-(methylamino)ethyl]phenol, dl-Mesatone, dl-Phenylephrine, R,S-Phenylephrine, (+/-)-phenylephrine, 3-(1-hydroxy-2-(methylamino)ethyl)phenol, Benzenemethanol, 3-hydroxy-a-[(methylamino)methyl]-, (+-)-Neosynephrine, (+-)-Phenylephrine or (R)-3-Hydroxy-α-[(methylamino)methyl]benzenemethanol hydrochloride) is a sympathomimetic substance of the phenylethanolamine class.
Chemistry
Salts and Esters []
Phenylephrine is typically found in the form of its bitartrate and hydrochloride salts
or its palmitate ester.
Stereochemistry []
(RS)-Phenylephrine is a racemic mixture of the optical stereoisomers.
Subjective effects []
Legal status []
- United Kingdom: Phenylephrine is a GSL substance.
- United States: Phenylephrine is a OTC substance.