Anodyne| DA | |
|---|---|
 |
| Salts [] | |
|---|---|
| Dopamine hydrochloride | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C8H11NO2[1] |
|---|---|
| Molecular mass | 153.18 g/mol[1] |
| Appearance | Stout prisms[1] |
| Predicted LogP | -1[1] |
| Melting point | 128 °C[1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrous oxides/.[1] |
| Solubility | Freely sol in water; sol in methanol, in hot 95% ethanol, in aq soln of alkali hydroxides; practically insol in petroleum ether, ether, benzene, chloroform, toluene /Hydrochloride/[1] |
| Chirality | achiral[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 4-(2-aminoethyl)benzene-1,2-diol[1] |
| SMILES | C1=CC(=C(C=C1CCN)O)O[1] |
| InChI | InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2[1] |
| InChIKey | VYFYYTLLBUKUHU-UHFFFAOYSA-N[1] |
| Dosing |
|---|
Dopamine
Dopamine (also known as 4-(2-Aminoethyl)benzene-1,2-diol, 3-Hydroxytyramine, Oxytyramine, Hydroxytyramin, Dopamin, 3,4-dihydroxyphenethylamine, hydroxytyramine, 4-(2-Aminoethyl)catechol, 2-(3,4-dihydroxyphenyl)ethylamine or Dopamina) is a neurotransmitters substance of the catecholamine class.
Chemistry
Dopamine is typically found in the form of its hydrochloride salt.
Stereochemistry
Dopamine is a achiral mixture