Mebufotenin
| 5-MeO-DMT | |
|---|---|
| Esters [] | |
|---|---|
| Mebufotenin benzoate | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 218.29 g/mol [1] |
| Solubility | >32.7 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 1.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C13H18N2O [1] |
| IUPAC name | 2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine [1] |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)OC [1] |
| InChI | InChI=1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3 [1] |
| InChIKey | ZSTKHSQDNIGFLM-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | Minutes (12–19 min in mice, 6–16 min in rats) |
| Duration of action | * Inhalation: 10–30 min * Intranasal: 45–70 min * Intramuscular: ≤60 min |
Mebufotenin (also known as N,N-Dimethyl-5-methoxytryptamine, 5-Methoxy-N,N-dimethyltryptamine, O-Methylbufotenine, MeODMT, Methylbufotenine, Bufotenine, O-methyl-, 3-(2-Dimethylaminoethyl)-5-methoxyindole, 2-(5-Methoxy-1H-indol-3-yl)-N,N-dimethylethanamine, 1H-Indole-3-ethanamine, 5-methoxy-N,N-dimethyl- or CT 4334) is a
Chemistry
Salts and Esters []
Mebufotenin is typically found in the form of its succinate salt
or its benzoate ester.
Stereochemistry []
Mebufotenin is a achiral mixture.
Subjective effects []
Legal status []
- Brazil: Mebufotenin is a F2 substance.
- United Kingdom: Mebufotenin is a Class A substance.
- United States: Mebufotenin is a Schedule I substance.
- Germany: Mebufotenin is a Anlage I substance.