Anodyne| Gly | |
|---|---|
 |
| Salts [] | |
|---|---|
| Glycine hydrochloride | |
| |
| Glycine hydriodide | |
|
| Esters [] | |
|---|---|
| Glycine acetate | |
| |
| Glycine benzoate | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C2H5NO2[1] |
|---|---|
| Molecular mass | 75.07 g/mol[1] |
| Density | 1.1607 (NTP, 1992) - Denser than water; will sink g/cm3[1] |
| Appearance | White crystals[1] |
| Odor | Odorless[1] |
| Taste | Sweet[1] |
| Predicted LogP | -3.2[1] |
| Melting point | 451 °[1] |
| Decomposition | STARTS TO DECOMP AT 233 °C[1] |
| Solubility | greater than or equal to 100 mg/mL at 64 °F (NTP, 1992)[1] |
| Chirality | achiral[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-aminoacetic acid[1] |
| SMILES | C(C(=O)O)N[1] |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)[1] |
| InChIKey | DHMQDGOQFOQNFH-UHFFFAOYSA-N[1] |
| Dosing |
|---|
Glycine
Glycine (also known as Glycocoll, Glycolixir, Glicoamin, Glycosthene, Aciport, Padil, Hampshire glycine, Amitone, Leimzucker or Aminoazijnzuur) is a substance of the alcohol class.
Chemistry
Glycine is typically found in the form of its hydrochloride and hydriodide salts or its acetate and benzoate esters.
Stereochemistry
Glycine is a achiral mixture