Gly | |
---|---|
Esters [] | |
---|---|
Glycine acetate | |
Glycine benzoate | |
Molecular structure via molpic based on CDK |
Physical properties [] | |
---|---|
Molecular mass | 75.07 g/mol [1] |
Density | 1.1607 (NTP, 1992) - Denser than water; will sink g/cm3 [1] |
Appearance | White crystals [1] |
Odor | Odorless [1] |
Taste | Sweet [1] |
Melting point | 451 ° [1] |
Decomposition | STARTS TO DECOMP AT 233 °C [1] |
Solubility | greater than or equal to 100 mg/mL at 64 °F (NTP, 1992) [1] |
Predicted LogP | -3.2 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C2H5NO2 [1] |
IUPAC name | 2-aminoacetic acid [1] |
SMILES | C(C(=O)O)N [1] |
InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) [1] |
InChIKey | DHMQDGOQFOQNFH-UHFFFAOYSA-N [1] |
Glycine
Glycine (also known as Glycocoll, Glycolixir, Glicoamin, Glycosthene, Aciport, Padil, Hampshire glycine, Amitone, Leimzucker or Aminoazijnzuur) is a
Chemistry
Salts and Esters []
Glycine is typically found in the form of its hydrochloride and hydriodide salts
or its acetate and benzoate esters.
Stereochemistry []
Glycine is a achiral mixture