Anodyne| Glu | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 147.13 g/mol [1] |
| Predicted LogP | -3.7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C5H9NO4 [1] |
| IUPAC name | 2-aminopentanedioic acid [1] |
| SMILES | C(CC(=O)O)C(C(=O)O)N [1] |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10) [1] |
| InChIKey | WHUUTDBJXJRKMK-UHFFFAOYSA-N [1] |
Glutamic acid
(Redirected from Glutamic acid)Glutamic acid (also known as DL-Glutamic acid, Glutamic acid DL-form, 4-04-00-03028, Glutamic acid, dl-(ii), Glutamic acid, dl-[ii], Glutamic acid, dl, Glutamic acid DLform, 2-azaniumyl-5-hydroxy-5-oxopentanoate, Glutaminsaeure or H-DL-Glu-OH) is a
Chemistry
Salts []
Glutamic acid is typically found in the form of its hydrochloride salt.
Stereochemistry []
DL-Glutamic acid is a racemic mixture of the logical stereoisomers