Flunitrazepam
| Flunitrazepam | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 313.28 g/mol [1] |
| Appearance | Pale yellow needles from methylene chloride-hexane [1] |
| Melting point | 166-167 °C [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /fluoride & nitrogen oxides/. [1] |
| Solubility | 8.58e-03 g/L [1] |
| Predicted LogP | 2.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C16H12FN3O3 [1] |
| IUPAC name | 5-(2-fluorophenyl)-1-methyl-7-nitro-3H-1,4-benzodiazepin-2-one [1] |
| SMILES | CN1C(=O)CN=C(C2=C1C=CC(=C2)[N+](=O)[O-])C3=CC=CC=C3F [1] |
| InChI | InChI=1S/C16H12FN3O3/c1-19-14-7-6-10(20(22)23)8-12(14)16(18-9-15(19)21)11-4-2-3-5-13(11)17/h2-8H,9H2,1H3 [1] |
| InChIKey | PPTYJKAXVCCBDU-UHFFFAOYSA-N [1] |
| Dosing[] |
|---|
| Oral [] | |
|---|---|
| Threshold | 0.5 - 1 |
| Light | ≤ 1 |
| Common | 1 |
| Strong | 1 - 2 |
| Heavy | 2 - 5.699999999999998 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Flunitrazepam (also known as Rohypnol, Narcozep, Roipnol, Fluninoc, Primun, flunipam, Flunitrazepamum, Fluridrazepam, Silece or Ro 5-4200) is a
Chemistry
Salts []
Flunitrazepam is typically found in the form of its hydrochloride salt.
Stereochemistry []
Flunitrazepam is a achiral mixture.