Flumazenil | |
---|---|
Molecular structure via molpic | |
Conformer structure via 3Dmol.js | |
Molecular formula | C15H14FN3O3 |
Molecular mass | 303.29 g/mol |
Predicted LogP | 1 |
Melting point | 201-203 °C |
Solubility | 1.04e+00 g/L |
Chirality | achiral |
Identifiers [] | |
---|---|
IUPAC name | ethyl 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
SMILES | CCOC(=O)C1=C2CN(C(=O)C3=C(N2C=N1)C=CC(=C3)F)C |
InChI | InChI=1S/C15H14FN3O3/c1-3-22-15(21)13-12-7-18(2)14(20)10-6-9(16)4-5-11(10)19(12)8-17-13/h4-6,8H,3,7H2,1-2H3 |
InChIKey | OFBIFZUFASYYRE-UHFFFAOYSA-N |
Dosing |
---|
Flumazenil
Flumazenil (also known as Flumazepil, Mazicon, Flumazenilum, Flumazenilo, Ro-15-1788, Flumazil, Ro15-1788, RO-151788, Ro 15-1788/000 or RO-1722) is a opioid substance of the benzodiazepine class.