Ergonovine | |
---|---|
Salts [] | |
---|---|
Ergonovine tartrate | |
Ergonovine maleate | |
Molecular structure via molpic | |
Conformer structure via 3Dmol.js | |
Molecular formula | C19H23N3O2 |
---|---|
Molecular mass | 325.4 g/mol |
Appearance | Plates or needles |
Predicted LogP | 1.8 |
Melting point | 162 °C |
Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. |
Solubility | Freely soluble in lower alcohols, ethyl acetate, acetone; more soluble in water than other principal alkaloids of ergot; slightly soluble in chloroform |
Chirality | absolute |
Identifiers [] | |
---|---|
IUPAC name | (6aR,9R)-N-[(2S)-1-hydroxypropan-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
SMILES | C[C@@H](CO)NC(=O)[C@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C |
InChI | InChI=1S/C19H23N3O2/c1-11(10-23)21-19(24)13-6-15-14-4-3-5-16-18(14)12(8-20-16)7-17(15)22(2)9-13/h3-6,8,11,13,17,20,23H,7,9-10H2,1-2H3,(H,21,24)/t11-,13+,17+/m0/s1 |
InChIKey | WVVSZNPYNCNODU-XTQGRXLLSA-N |
Dosing |
---|
Ergonovine
Ergonovine (also known as Ergometrine, Ergotocine, Ergostetrine, Ergometrin, Margonovine, Ergotrate, Ergoklinine, Secacornin, Secometrin or Neofemergen) is a hormone substance of the lysergamide class.
Chemistry
Ergonovine is typically found in the form of its tartrate and maleate salts.