| Diclofenac | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 296.1 g/mol [1] |
| Appearance | Crystals from ether-petroleum ether [1] |
| Melting point | 283-285 °C [1] |
| Solubility | In water, 2.37 mg/L at 25 °C [1] |
| Predicted LogP | 4.4 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C14H11Cl2NO2 [1] |
| IUPAC name | 2-[2-(2,6-dichloroanilino)phenyl]acetic acid [1] |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=CC=C2Cl)Cl [1] |
| InChI | InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19) [1] |
| InChIKey | DCOPUUMXTXDBNB-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 1.2–2 h (35% of the drug enters enterohepatic recirculation) |
Diclofenac
Diclofenac (also known as Diclofenac acid, dichlofenac, Diclofenaco, Diclophenac, Diclofenacum, ProSorb-D, Zorovolex, Zorvolex, Diclofenamic acid or Benzeneacetic acid, 2-[(2,6-dichlorophenyl)amino]-) is a nonsteroidal anti-inflammatory drug substance of the gabapentinoid class.
Chemistry
Stereochemistry []
Diclofenac is a achiral mixture
Legal status
- Australia: Diclofenac is a S4 substance.
- Canada: Diclofenac is a prescription only substance.
- United Kingdom: Diclofenac is a prescription only substance.
- United States: Diclofenac is a prescription only substance.
Anodyne