Benfluorex
| Benfluorex | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 351.4 g/mol [1] |
| Predicted LogP | 4.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C19H20F3NO2 [1] |
| IUPAC name | 2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl benzoate [1] |
| SMILES | CC(CC1=CC(=CC=C1)C(F)(F)F)NCCOC(=O)C2=CC=CC=C2 [1] |
| InChI | InChI=1S/C19H20F3NO2/c1-14(12-15-6-5-9-17(13-15)19(20,21)22)23-10-11-25-18(24)16-7-3-2-4-8-16/h2-9,13-14,23H,10-12H2,1H3 [1] |
| InChIKey | CJAVTWRYCDNHSM-UHFFFAOYSA-N [1] |
Benfluorex (also known as Benfluramate, Minolip, N-(2-Benzoyloxyethyl)norfenfluramine, JP 992, Benfluorexum, 2-((1-(3-(trifluoromethyl)phenyl)propan-2-yl)amino)ethyl benzoate, Ethanol, 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]-, benzoate, SE 780, Smr000857234 or Benflurorex) is a
Chemistry
Salts []
Benfluorex is typically found in the form of its hydrochloride salt.
Stereochemistry []
(RS)-Benfluorex is a racemic mixture of the optical stereoisomers.
Pharmacology
ATC Classification
In the alimentary tract and metabolism (A) benfluorex actsMetabolism
Subjective effects []
Legal status []
- Brazil: Benfluorex is a C1 substance.