Atropine
| Atropine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 289.4 g/mol [1] |
| Solubility | >43.4 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 1.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C17H23NO3 [1] |
| IUPAC name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate [1] |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C(CO)C3=CC=CC=C3 [1] |
| InChI | InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15?,16? [1] |
| InChIKey | RKUNBYITZUJHSG-PJPHBNEVSA-N [1] |
Atropine (also known as 51-55-8, dl-Hyoscyamine, Tropine tropate, Atropen, Atropin, dl-Tropyltropate, Atropinol, Eyesules, Isopto-atropine or Troyl tropate) is a
Chemistry
Salts []
Atropine is typically found in the form of its hydrobromide, sulfate, tartrate and hydrochloride salts.
Stereochemistry []
Atropine is a racemic mixture of the optical stereoisomers.