Acetylsalicylic acid
| ASA | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 180.16 g/mol [1] |
| Density | 1.4 (NTP, 1992) - Denser than water; will sink g/cm3 [1] |
| Appearance | Monoclinic tablets or needle-like crystals [1] |
| Odor | Odorless, but in moist air it is gradually hydrolyzed and acquires odor of acetic acid [1] |
| Melting point | 275 ° [1] |
| Boiling point | 284 ° [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and fumes. [1] |
| Solubility | less than 1 mg/mL at 73 °F (NTP, 1992) [1] |
| Predicted LogP | 1.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H8O4 [1] |
| IUPAC name | 2-acetyloxybenzoic acid [1] |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)O [1] |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) [1] |
| InChIKey | BSYNRYMUTXBXSQ-UHFFFAOYSA-N [1] |
Acetylsalicylic acid (also known as aspirin, 2-Acetoxybenzoic acid, 2-(Acetyloxy)benzoic acid, Acetosal, O-Acetylsalicylic acid, o-Acetoxybenzoic acid, Acenterine, Acetophen, Acylpyrin or Easprin)
Chemistry
Salts []
Acetylsalicylic acid is typically found in the form of its salicylate salt.
Stereochemistry []
Acetylsalicylic acid is a achiral mixture.