| 4-MeMABP | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 191.27 g/mol [1] |
| Predicted LogP | 2.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H17NO [1] |
| IUPAC name | 2-(methylamino)-1-(4-methylphenyl)butan-1-one [1] |
| SMILES | CCC(C(=O)C1=CC=C(C=C1)C)NC [1] |
| InChI | InChI=1S/C12H17NO/c1-4-11(13-3)12(14)10-7-5-9(2)6-8-10/h5-8,11,13H,4H2,1-3H3 [1] |
| InChIKey | ZOGGCQVVLHCLHY-UHFFFAOYSA-N [1] |
4-Methylbuphedrone
4-Methylbuphedrone (also known as 1-Butanone, 2-(methylamino)-1-(4-methylphenyl)-, 4Y78FRB99G, 4-MeMABP, ZOGGCQVVLHCLHY-UHFFFAOYSA-N or 4-Methyl-alpha-methylamino-butyrophenone) is a
Chemistry
Salts []
4-Methylbuphedrone is typically found in the form of its hydrochloride salt.
Stereochemistry []
4-Methylbuphedrone is a racemic mixture of the optical stereoisomers
| Anodyne Usernotes [] | |
|---|---|
| 0xea / 4-Methylbuphedrone[hydrochloride] via Insufflated, Intrarectal, Intravenous at 30mg insufflated, 40mg intrarectal and 20-50mg intravenous |
|