3,4-Dimethylmethcathinone
| 3,4-DMMC | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 191.27 g/mol [1] |
| Predicted LogP | 2.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H17NO [1] |
| IUPAC name | 1-(3,4-dimethylphenyl)-2-(methylamino)propan-1-one [1] |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(C)NC)C [1] |
| InChI | InChI=1S/C12H17NO/c1-8-5-6-11(7-9(8)2)12(14)10(3)13-4/h5-7,10,13H,1-4H3 [1] |
| InChIKey | IBZRXTVDTGVBIS-UHFFFAOYSA-N [1] |
3,4-Dimethylmethcathinone (also known as 3,4-DMMC HCl, 3,4-Dimethylmethcathinone hydrochloride, J3.065.113h, 1-Propanone, 1-(3,4-dimethylphenyl)-2-(methylamino)-, (+/-)-1-(3,4-Dimethylphenyl)-2-(methylamino)propan-1-one or 1-(3,4-dimethylphenyl)-2-methylaminopropan-1-one) is a
Chemistry
Stereochemistry []
(RS)-3,4-Dimethylmethcathinone is a racemic mixture of the optical stereoisomers.
Subjective effects []
Legal status []
- United Kingdom: 3,4-Dimethylmethcathinone is a Class B substance.
- United States: 3,4-Dimethylmethcathinone is a Schedule I substance.
- Germany: 3,4-Dimethylmethcathinone is a Anlage II substance.