2-Phenylphenol
| 2-Phenylphenol | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 170.21 g/mol [1] |
| Density | 1.213 at 77 °F (NTP, 1992) - Denser than water; will sink g/cm3 [1] |
| Appearance | Needles from petroleum ether [1] |
| Odor | Mild characteristic odor [1] |
| Melting point | 131.9 to 135.5 °F (NTP, 1992) [1] |
| Boiling point | 527 ° [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | less than 0.1 mg/mL at 68.9 °F (NTP, 1992) [1] |
| Predicted LogP | 3.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H10O [1] |
| IUPAC name | 2-phenylphenol [1] |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2O [1] |
| InChI | InChI=1S/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H [1] |
| InChIKey | LLEMOWNGBBNAJR-UHFFFAOYSA-N [1] |
2-Phenylphenol (also known as 2-Hydroxybiphenyl, O-phenylphenol, Biphenyl-2-ol, 2-Biphenylol, o-Hydroxybiphenyl, 2-Hydroxydiphenyl, o-Hydroxydiphenyl, o-Phenyl phenol, Phenylphenol or Orthophenylphenol) is a
Chemistry
Stereochemistry []
2-Phenylphenol is a achiral mixture