| β-Carboline | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 168.19 g/mol [1] |
| Melting point | 199 °C [1] |
| Solubility | >25.2 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 3.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C11H8N2 [1] |
| IUPAC name | 9H-pyrido[3,4-b]indole [1] |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=NC=C3 [1] |
| InChI | InChI=1S/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H [1] |
| InChIKey | AIFRHYZBTHREPW-UHFFFAOYSA-N [1] |
β-Carboline
β-Carboline (also known as 9H-Pyrido[3,4-B]indole, Norharman, Norharmane, 2,9-Diazafluorene, Carbazoline, 9H-β-carboline, 2-Azacarbazole, .β.-Carboline, 9H-Pyrido(3,4-B)indole or CCRIS 6915) is a
Chemistry
Salts []
β-Carboline is typically found in the form of its hydrochloride salt.
Stereochemistry []
β-Carboline is a achiral mixture