GABA | |
---|---|
Molecular structure via molpic based on CDK |
Physical properties [] | |
---|---|
Molecular mass | 103.12 g/mol [1] |
Melting point | 203 °C [1] |
Solubility | 1.2 [ug/mL] (The mean of the results at pH 7.4) [1] |
Predicted LogP | -3.2 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C4H9NO2 [1] |
IUPAC name | 4-aminobutanoic acid [1] |
SMILES | C(CC(=O)O)CN [1] |
InChI | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) [1] |
InChIKey | BTCSSZJGUNDROE-UHFFFAOYSA-N [1] |
γ-Aminobutyric acid
(Redirected from γ-Aminobutyric acid)
γ-Aminobutyric acid (also known as 4-Aminobutanoic acid, Piperidic acid, Piperidinic acid, Aminalon, Gaballon, γlone, γsol, Mielomade, Gamarex or γr) is a
Chemistry
Salts []
γ-Aminobutyric acid is typically found in the form of its hydrochloride salt.
Stereochemistry []
γ-Aminobutyric acid is a achiral mixture
Anodyne Usernotes [] | |
---|---|
0xea / γ-Aminobutyric acid via | Uncertain Activity |