| Theodrenaline | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 375.4 g/mol [1] |
| Predicted LogP | -0.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C17H21N5O5 [1] |
| IUPAC name | 7-[2-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione [1] |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCNCC(C3=CC(=C(C=C3)O)O)O [1] |
| InChI | InChI=1S/C17H21N5O5/c1-20-15-14(16(26)21(2)17(20)27)22(9-19-15)6-5-18-8-13(25)10-3-4-11(23)12(24)7-10/h3-4,7,9,13,18,23-25H,5-6,8H2,1-2H3 [1] |
| InChIKey | WMCMJIGLYZDKRN-UHFFFAOYSA-N [1] |
Theodrenaline
Theodrenaline (also known as Teodrenalina, Noradrenaline theophylline, Norphedrinoethyltheophylline, Theodrenalina, Theodrenalinum, D 470, 5-26-14-00012, 7-(2-((2-(3,4-Dihydroxyphenyl)-2-hydroxyethyl)amino)ethyl)theophylline, 7-(2-(2-(3,4-Dihydroxyphenyl)-2-hydroxyethylamino)ethyl)theophylline or 7-(2-(2-Hydroxy-2-(3,4-dihydroxyphenyl)ethylamino)ethyl)theophylline) is a sympathomimetic substance of the phenylethanolamine and catecholamine class.
Chemistry
Salts []
Theodrenaline is typically found in the form of its hydrochloride salt.
Stereochemistry []
(RS)-Theodrenaline is a racemic mixture of the optical stereoisomers