Serine
| Ser | |
|---|---|
| Esters [] | |
|---|---|
| Serine palmitate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 105.09 g/mol [1] |
| Predicted LogP | -3.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C3H7NO3 [1] |
| IUPAC name | 2-amino-3-hydroxypropanoic acid [1] |
| SMILES | C(C(C(=O)O)N)O [1] |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) [1] |
| InChIKey | MTCFGRXMJLQNBG-UHFFFAOYSA-N [1] |
Serine (also known as DL-Serine, 2-Amino-3-hydroxypropanoic acid, Serine DL-form, Serine,, Serine, l-[3-3h], DL-2-Amino-3-hydroxypropionic Acid, L-Serine-2-13c-15N, Dl-serine, (+/-)-2-Amino-3-hydroxypropionic acid or H-DL-Ser-OH) is a
Chemistry
Esters []
Serine is typically found in the form of its palmitate ester.
Stereochemistry []
DL-Serine is a racemic mixture of the logical stereoisomers