Pseudoephedrine
| Pseudoephedrine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 165.23 g/mol [1] |
| Appearance | Crystals from ether [1] |
| Melting point | 118-118.7 °C [1] |
| Solubility | Sparingly sol in water; freely sol in alc or ether [1] |
| Predicted LogP | 0.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C10H15NO [1] |
| IUPAC name | (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol [1] |
| SMILES | C[C@@H]([C@H](C1=CC=CC=C1)O)NC [1] |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1 [1] |
| InChIKey | KWGRBVOPPLSCSI-WCBMZHEXSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 5.4 hours (range 3–16 hours dependent on urine pH) |
| Duration of action | 4–12 hours |
| Dosing[] |
|---|
| Oral [] | |
|---|---|
| Threshold | 2 - 60 |
| Light | 60 - 120 |
| Common | 120 |
| Strong | 120 |
| Heavy | 120 - 180 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Pseudoephedrine (also known as (+)-Pseudoephedrine, d-Pseudoephedrine, trans-Ephedrine, d-Isoephedrine, Psi-ephedrin, Psi-ephedrine, (+)-threo-Ephedrine, d-psi-Ephedrine, Pseudoefedrina or L(+)-psi-Ephedrine) is a sympathomimetic substance of the phenylethanolamine class.
Chemistry
Salts []
Pseudoephedrine is typically found in the form of its hydrochloride, sulfate and hydrobromide salts.
Stereochemistry []
Pseudoephedrine is a absolute mixture
Pharmacology
ATC Classification
Metabolism
Subjective effects []
| 0xea / Pseudoephedrine [] | |
|---|---|
| |
Legal status []
- Australia: Pseudoephedrine is a S3 substance.
- Brazil: Pseudoephedrine is a D1 substance.
- Canada: Pseudoephedrine is a OTC substance.
- United Kingdom: Pseudoephedrine is a P substance.
- United States: Pseudoephedrine is a OTC substance.