Proline
| Pro | |
|---|---|
| Esters [] | |
|---|---|
| Proline acetate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 115.13 g/mol [1] |
| Predicted LogP | -2.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C5H9NO2 [1] |
| IUPAC name | pyrrolidine-2-carboxylic acid [1] |
| SMILES | C1CC(NC1)C(=O)O [1] |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8) [1] |
| InChIKey | ONIBWKKTOPOVIA-UHFFFAOYSA-N [1] |
Proline (also known as Proline DL-form, CCRIS 8602, 2-Pyrrolidinylcarboxylic acid, (+-)-proline, 210-189-3, DL-Proline, H-DL-Pro-OH, D-Pyrrolidine-2-carboxylic acid, 2-Pyrrolidine carboxylic acid or Prolin) is a
Chemistry
Esters []
Proline is typically found in the form of its acetate ester.
Stereochemistry []
DL-Proline is a racemic mixture of the logical stereoisomers