Progesterone
| P4 | |
|---|---|
| Esters [] | |
|---|---|
| Progesterone propionate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 314.5 g/mol [1] |
| Density | 1.171 at 68 °F (NTP, 1992) - Denser than water; will sink g/cm3 [1] |
| Appearance | Prisms [1] |
| Odor | Odorless [1] |
| Melting point | 250 to 252 °F (NTP, 1992) [1] |
| Boiling point | 394.13°C (rough estimate) [1] |
| Decomposition | When heated to decomposition, it emits acrid smoke and irritating fumes. [1] |
| Solubility | less than 1 mg/mL at 66 °F (NTP, 1992) [1] |
| Predicted LogP | 3.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C21H30O2 [1] |
| IUPAC name | (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one [1] |
| SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C [1] |
| InChI | InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 [1] |
| InChIKey | RJKFOVLPORLFTN-LEKSSAKUSA-N [1] |
Progesterone (also known as Agolutin, Prometrium, Luteol, Gestormone, Glanducorpin, Pregnenedione, Progesterol, Progesteronum, Progestone or Progestron) is a
Chemistry
Esters []
Progesterone is typically found in the form of its propionate ester.
Stereochemistry []
Progesterone is a absolute mixture.