Anodyne| Phe | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Physical properties [] | |
|---|---|
| Molecular mass | 165.19 g/mol [1] |
| Solubility | Soluble in water and dilute mineral acid and alkali hydroxide solutions [1] |
| Predicted LogP | -1.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H11NO2 [1] |
| IUPAC name | 2-amino-3-phenylpropanoic acid [1] |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)N [1] |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) [1] |
| InChIKey | COLNVLDHVKWLRT-UHFFFAOYSA-N [1] |
Phenylalanine
Phenylalanine (also known as Dl-phenylalanine, DL-3-Phenylalanine, Phenylalanine DL-form, Phenylalanine, dl-, DL-2-Amino-3-phenylpropanoic acid, FEMA No. 3726, d,l-phenylalanine, CCRIS 8601, AI3-18436 or Phenylalanine dl) is a
Chemistry
Salts []
Phenylalanine is typically found in the form of its hydrochloride and sodium salts.
Stereochemistry []
DL-Phenylalanine is a racemic mixture of the logical stereoisomers